C9H18N4O2 — CID 143368836
(2S)-N'-(2-iminoethyl)-N-methyl-2-(methylamino)pentanediamide (PubChem CID 143368836) has the molecular formula C9H18N4O2 and a molecular weight of 214.27 g/mol. Its IUPAC name is (2S)-N'-(2-iminoethyl)-N-methyl-2-(methylamino)pentanediamide.
| Compound Name | (2S)-N'-(2-iminoethyl)-N-methyl-2-(methylamino)pentanediamide |
|---|---|
| PubChem CID | 143368836 |
| Molecular Formula | C9H18N4O2 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | (2S)-N'-(2-iminoethyl)-N-methyl-2-(methylamino)pentanediamide |
| SMILES | [H]/N=C/CNC(=O)CC[C@H](NC)C(=O)NC |
| InChI | InChI=1S/C9H18N4O2/c1-11-7(9(15)12-2)3-4-8(14)13-6-5-10/h5,7,10-11H,3-4,6H2,1-2H3,(H,12,15)(H,13,14)/b10-5+/t7-/m0/s1 |
| InChIKey | MORILQCYWYRRDP-OYSUNCFMSA-N |
| XLogP | -1.13 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|