C19H35N5O5 — CID 91134427
(2S)-2-acetamido-N-methyl-N'-[(2Z)-2-[4-(pentanoylamino)butoxyimino]ethyl]pentanediamide (PubChem CID 91134427) has the molecular formula C19H35N5O5 and a molecular weight of 413.52 g/mol. Its IUPAC name is (2S)-2-acetamido-N-methyl-N'-[(2Z)-2-[4-(pentanoylamino)butoxyimino]ethyl]pentanediamide.
| Compound Name | (2S)-2-acetamido-N-methyl-N'-[(2Z)-2-[4-(pentanoylamino)butoxyimino]ethyl]pentanediamide |
|---|---|
| PubChem CID | 91134427 |
| Molecular Formula | C19H35N5O5 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | (2S)-2-acetamido-N-methyl-N'-[(2Z)-2-[4-(pentanoylamino)butoxyimino]ethyl]pentanediamide |
| SMILES | CCCCC(=O)NCCCCO/N=C\CNC(=O)CC[C@H](NC(C)=O)C(=O)NC |
| InChI | InChI=1S/C19H35N5O5/c1-4-5-8-17(26)21-11-6-7-14-29-23-13-12-22-18(27)10-9-16(19(28)20-3)24-15(2)25/h13,16H,4-12,14H2,1-3H3,(H,20,28)(H,21,26)(H,22,27)(H,24,25)/b23-13-/t16-/m0/s1 |
| InChIKey | VZGJTIFONLDORJ-YOBACFSGSA-N |
| XLogP | 0.22 |
| TPSA | 137.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|