C25H43N5O10 — CID 91485103
[2-[4-[4-[(Z)-2-[[(4S)-4-acetamido-5-(methylamino)-5-oxopentanoyl]amino]ethylideneamino]oxybutylamino]-4-oxobutoxy]-3-acetyloxypropyl] acetate (PubChem CID 91485103) has the molecular formula C25H43N5O10 and a molecular weight of 573.64 g/mol. Its IUPAC name is [2-[4-[4-[(Z)-2-[[(4S)-4-acetamido-5-(methylamino)-5-oxopentanoyl]amino]ethylideneamino]oxybutylamino]-4-oxobutoxy]-3-acetyloxypropyl] acetate.
| Compound Name | [2-[4-[4-[(Z)-2-[[(4S)-4-acetamido-5-(methylamino)-5-oxopentanoyl]amino]ethylideneamino]oxybutylamino]-4-oxobutoxy]-3-acetyloxypropyl] acetate |
|---|---|
| PubChem CID | 91485103 |
| Molecular Formula | C25H43N5O10 |
| Molecular Weight | 573.64 g/mol |
| Exact Mass | 573.30 |
| IUPAC Name | [2-[4-[4-[(Z)-2-[[(4S)-4-acetamido-5-(methylamino)-5-oxopentanoyl]amino]ethylideneamino]oxybutylamino]-4-oxobutoxy]-3-acetyloxypropyl] acetate |
| SMILES | CNC(=O)[C@H](CCC(=O)NC/C=N\OCCCCNC(=O)CCCOC(COC(C)=O)COC(C)=O)NC(C)=O |
| InChI | InChI=1S/C25H43N5O10/c1-18(31)30-22(25(36)26-4)9-10-24(35)28-12-13-29-40-15-6-5-11-27-23(34)8-7-14-37-21(16-38-19(2)32)17-39-20(3)33/h13,21-22H,5-12,14-17H2,1-4H3,(H,26,36)(H,27,34)(H,28,35)(H,30,31)/b29-13-/t22-/m0/s1 |
| InChIKey | AFKDVUNEQUXFDC-DHCNTSDESA-N |
| XLogP | -0.68 |
| TPSA | 199.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.64 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|