C13H25N3O4 — CID 59766537
4-ethoxy-N-[4-[(E)-[2-(methylamino)-2-oxoethylidene]amino]oxybutyl]butanamide (PubChem CID 59766537) has the molecular formula C13H25N3O4 and a molecular weight of 287.36 g/mol. Its IUPAC name is 4-ethoxy-N-[4-[(E)-[2-(methylamino)-2-oxoethylidene]amino]oxybutyl]butanamide.
| Compound Name | 4-ethoxy-N-[4-[(E)-[2-(methylamino)-2-oxoethylidene]amino]oxybutyl]butanamide |
|---|---|
| PubChem CID | 59766537 |
| Molecular Formula | C13H25N3O4 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | 4-ethoxy-N-[4-[(E)-[2-(methylamino)-2-oxoethylidene]amino]oxybutyl]butanamide |
| SMILES | CCOCCCC(=O)NCCCCO/N=C/C(=O)NC |
| InChI | InChI=1S/C13H25N3O4/c1-3-19-9-6-7-12(17)15-8-4-5-10-20-16-11-13(18)14-2/h11H,3-10H2,1-2H3,(H,14,18)(H,15,17)/b16-11+ |
| InChIKey | HDXGAEUNHHOJBC-LFIBNONCSA-N |
| XLogP | 0.45 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|