C29H52N8O8 — CID 123564763
N'-(7-amino-2-oxoheptan-3-yl)-N-[2-[3-[2-[[4-[(7-amino-2-oxoheptan-3-yl)amino]-4-oxobutanoyl]amino]ethylideneamino]oxypropoxyimino]ethyl]butanediamide (PubChem CID 123564763) has the molecular formula C29H52N8O8 and a molecular weight of 640.78 g/mol. Its IUPAC name is N'-(7-amino-2-oxoheptan-3-yl)-N-[2-[3-[2-[[4-[(7-amino-2-oxoheptan-3-yl)amino]-4-oxobutanoyl]amino]ethylideneamino]oxypropoxyimino]ethyl]butanediamide.
| Compound Name | N'-(7-amino-2-oxoheptan-3-yl)-N-[2-[3-[2-[[4-[(7-amino-2-oxoheptan-3-yl)amino]-4-oxobutanoyl]amino]ethylideneamino]oxypropoxyimino]ethyl]butanediamide |
|---|---|
| PubChem CID | 123564763 |
| Molecular Formula | C29H52N8O8 |
| Molecular Weight | 640.78 g/mol |
| Exact Mass | 640.39 |
| IUPAC Name | N'-(7-amino-2-oxoheptan-3-yl)-N-[2-[3-[2-[[4-[(7-amino-2-oxoheptan-3-yl)amino]-4-oxobutanoyl]amino]ethylideneamino]oxypropoxyimino]ethyl]butanediamide |
| SMILES | CC(=O)C(CCCCN)NC(=O)CCC(=O)NCC=NOCCCON=CCNC(=O)CCC(=O)NC(CCCCN)C(C)=O |
| InChI | InChI=1S/C29H52N8O8/c1-22(38)24(8-3-5-14-30)36-28(42)12-10-26(40)32-16-18-34-44-20-7-21-45-35-19-17-33-27(41)11-13-29(43)37-25(23(2)39)9-4-6-15-31/h18-19,24-25H,3-17,20-21,30-31H2,1-2H3,(H,32,40)(H,33,41)(H,36,42)(H,37,43) |
| InChIKey | NJPUTYDEELKQPS-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 245.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.78 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|