C14H26N2O4 — CID 102426920
ethyl (4S)-4-acetamido-5-oxo-5-(pentylamino)pentanoate (PubChem CID 102426920) has the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. Its IUPAC name is ethyl (4S)-4-acetamido-5-oxo-5-(pentylamino)pentanoate.
| Compound Name | ethyl (4S)-4-acetamido-5-oxo-5-(pentylamino)pentanoate |
|---|---|
| PubChem CID | 102426920 |
| Molecular Formula | C14H26N2O4 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | ethyl (4S)-4-acetamido-5-oxo-5-(pentylamino)pentanoate |
| SMILES | CCCCCNC(=O)[C@H](CCC(=O)OCC)NC(C)=O |
| InChI | InChI=1S/C14H26N2O4/c1-4-6-7-10-15-14(19)12(16-11(3)17)8-9-13(18)20-5-2/h12H,4-10H2,1-3H3,(H,15,19)(H,16,17)/t12-/m0/s1 |
| InChIKey | LPYROCSKGRJZGG-LBPRGKRZSA-N |
| XLogP | 1.14 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|