C17H31N3O6 — CID 89292971
methyl 5-(hexylamino)-4-[[2-[(2-hydroxyacetyl)-methylamino]acetyl]amino]-5-oxopentanoate (PubChem CID 89292971) has the molecular formula C17H31N3O6 and a molecular weight of 373.45 g/mol. Its IUPAC name is methyl 5-(hexylamino)-4-[[2-[(2-hydroxyacetyl)-methylamino]acetyl]amino]-5-oxopentanoate.
| Compound Name | methyl 5-(hexylamino)-4-[[2-[(2-hydroxyacetyl)-methylamino]acetyl]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 89292971 |
| Molecular Formula | C17H31N3O6 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | methyl 5-(hexylamino)-4-[[2-[(2-hydroxyacetyl)-methylamino]acetyl]amino]-5-oxopentanoate |
| SMILES | CCCCCCNC(=O)C(CCC(=O)OC)NC(=O)CN(C)C(=O)CO |
| InChI | InChI=1S/C17H31N3O6/c1-4-5-6-7-10-18-17(25)13(8-9-16(24)26-3)19-14(22)11-20(2)15(23)12-21/h13,21H,4-12H2,1-3H3,(H,18,25)(H,19,22) |
| InChIKey | KBJLWSGGFGIQAF-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|