C23H46N4O7 — CID 166076203
3-[2-(2-aminoethoxy)ethoxy]-N-(2-oxoethyl)propanamide;2-methylpropane;propan-2-yl (2S)-6-imino-2-(methylamino)-5-oxohexanoate (PubChem CID 166076203) has the molecular formula C23H46N4O7 and a molecular weight of 490.64 g/mol. Its IUPAC name is 3-[2-(2-aminoethoxy)ethoxy]-N-(2-oxoethyl)propanamide;2-methylpropane;propan-2-yl (2S)-6-imino-2-(methylamino)-5-oxohexanoate.
| Compound Name | 3-[2-(2-aminoethoxy)ethoxy]-N-(2-oxoethyl)propanamide;2-methylpropane;propan-2-yl (2S)-6-imino-2-(methylamino)-5-oxohexanoate |
|---|---|
| PubChem CID | 166076203 |
| Molecular Formula | C23H46N4O7 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.34 |
| IUPAC Name | 3-[2-(2-aminoethoxy)ethoxy]-N-(2-oxoethyl)propanamide;2-methylpropane;propan-2-yl (2S)-6-imino-2-(methylamino)-5-oxohexanoate |
| SMILES | CC(C)C.NCCOCCOCCC(=O)NCC=O.[H]/N=C/C(=O)CC[C@H](NC)C(=O)OC(C)C |
| InChI | InChI=1S/C10H18N2O3.C9H18N2O4.C4H10/c1-7(2)15-10(14)9(12-3)5-4-8(13)6-11;10-2-6-15-8-7-14-5-1-9(13)11-3-4-12;1-4(2)3/h6-7,9,11-12H,4-5H2,1-3H3;4H,1-3,5-8,10H2,(H,11,13);4H,1-3H3/b11-6+;;/t9-;;/m0../s1 |
| InChIKey | IACTUHWJKVYWKH-VMRPDLTNSA-N |
| XLogP | 0.87 |
| TPSA | 169.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|