C17H31N3O5 — CID 170744850
4-imino-N,2-dimethyl-N-[3-oxo-3-[2-[2-(3-oxobutoxy)ethoxy]ethylamino]propyl]butanamide (PubChem CID 170744850) has the molecular formula C17H31N3O5 and a molecular weight of 357.45 g/mol. Its IUPAC name is 4-imino-N,2-dimethyl-N-[3-oxo-3-[2-[2-(3-oxobutoxy)ethoxy]ethylamino]propyl]butanamide.
| Compound Name | 4-imino-N,2-dimethyl-N-[3-oxo-3-[2-[2-(3-oxobutoxy)ethoxy]ethylamino]propyl]butanamide |
|---|---|
| PubChem CID | 170744850 |
| Molecular Formula | C17H31N3O5 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | 4-imino-N,2-dimethyl-N-[3-oxo-3-[2-[2-(3-oxobutoxy)ethoxy]ethylamino]propyl]butanamide |
| SMILES | [H]/N=C/CC(C)C(=O)N(C)CCC(=O)NCCOCCOCCC(C)=O |
| InChI | InChI=1S/C17H31N3O5/c1-14(4-7-18)17(23)20(3)9-5-16(22)19-8-11-25-13-12-24-10-6-15(2)21/h7,14,18H,4-6,8-13H2,1-3H3,(H,19,22)/b18-7+ |
| InChIKey | CPTOLGNQLOGONN-CNHKJKLMSA-N |
| XLogP | 0.64 |
| TPSA | 108.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|