C20H39N3O5 — CID 178094533
ethane;3-[methyl-[(Z)-4-oxobut-2-enimidoyl]amino]-N-[2-[2-(2-oxopropoxy)ethoxy]ethyl]propanamide;propane (PubChem CID 178094533) has the molecular formula C20H39N3O5 and a molecular weight of 401.55 g/mol. Its IUPAC name is ethane;3-[methyl-[(Z)-4-oxobut-2-enimidoyl]amino]-N-[2-[2-(2-oxopropoxy)ethoxy]ethyl]propanamide;propane.
| Compound Name | ethane;3-[methyl-[(Z)-4-oxobut-2-enimidoyl]amino]-N-[2-[2-(2-oxopropoxy)ethoxy]ethyl]propanamide;propane |
|---|---|
| PubChem CID | 178094533 |
| Molecular Formula | C20H39N3O5 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.29 |
| IUPAC Name | ethane;3-[methyl-[(Z)-4-oxobut-2-enimidoyl]amino]-N-[2-[2-(2-oxopropoxy)ethoxy]ethyl]propanamide;propane |
| SMILES | CC.CCC.[H]/N=C(\C=C/C=O)N(C)CCC(=O)NCCOCCOCC(C)=O |
| InChI | InChI=1S/C15H25N3O5.C3H8.C2H6/c1-13(20)12-23-11-10-22-9-6-17-15(21)5-7-18(2)14(16)4-3-8-19;1-3-2;1-2/h3-4,8,16H,5-7,9-12H2,1-2H3,(H,17,21);3H2,1-2H3;1-2H3/b4-3-,16-14+;; |
| InChIKey | DKCUTESPOAERDC-DAGUTBOGSA-N |
| XLogP | 2.22 |
| TPSA | 108.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|