C18H33NO5 — CID 143366489
hexane;(Z)-N-methyl-4-oxo-N-[2-[2-(2-oxopropoxy)ethoxy]ethyl]but-2-enamide (PubChem CID 143366489) has the molecular formula C18H33NO5 and a molecular weight of 343.46 g/mol. Its IUPAC name is hexane;(Z)-N-methyl-4-oxo-N-[2-[2-(2-oxopropoxy)ethoxy]ethyl]but-2-enamide.
| Compound Name | hexane;(Z)-N-methyl-4-oxo-N-[2-[2-(2-oxopropoxy)ethoxy]ethyl]but-2-enamide |
|---|---|
| PubChem CID | 143366489 |
| Molecular Formula | C18H33NO5 |
| Molecular Weight | 343.46 g/mol |
| Exact Mass | 343.24 |
| IUPAC Name | hexane;(Z)-N-methyl-4-oxo-N-[2-[2-(2-oxopropoxy)ethoxy]ethyl]but-2-enamide |
| SMILES | CC(=O)COCCOCCN(C)C(=O)/C=C\C=O.CCCCCC |
| InChI | InChI=1S/C12H19NO5.C6H14/c1-11(15)10-18-9-8-17-7-5-13(2)12(16)4-3-6-14;1-3-5-6-4-2/h3-4,6H,5,7-10H2,1-2H3;3-6H2,1-2H3/b4-3-; |
| InChIKey | MOEXOZDMBIRPTN-LNKPDPKZSA-N |
| XLogP | 2.41 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.46 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|