C12H25NO2 — CID 163400229
N,2-dimethyl-N-(2-pentoxyethyl)propanamide (PubChem CID 163400229) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is N,2-dimethyl-N-(2-pentoxyethyl)propanamide.
| Compound Name | N,2-dimethyl-N-(2-pentoxyethyl)propanamide |
|---|---|
| PubChem CID | 163400229 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | N,2-dimethyl-N-(2-pentoxyethyl)propanamide |
| SMILES | CCCCCOCCN(C)C(=O)C(C)C |
| InChI | InChI=1S/C12H25NO2/c1-5-6-7-9-15-10-8-13(4)12(14)11(2)3/h11H,5-10H2,1-4H3 |
| InChIKey | HYPAWSSVQQUBBH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|