C12H25NO2 — CID 89427319
3-hexoxy-N,N,2-trimethylpropanamide (PubChem CID 89427319) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is 3-hexoxy-N,N,2-trimethylpropanamide.
| Compound Name | 3-hexoxy-N,N,2-trimethylpropanamide |
|---|---|
| PubChem CID | 89427319 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | 3-hexoxy-N,N,2-trimethylpropanamide |
| SMILES | CCCCCCOCC(C)C(=O)N(C)C |
| InChI | InChI=1S/C12H25NO2/c1-5-6-7-8-9-15-10-11(2)12(14)13(3)4/h11H,5-10H2,1-4H3 |
| InChIKey | PDCLWKKVHRJLEK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|