C9H15NO — CID 168967318
(2Z)-4-[methyl(propyl)amino]penta-2,4-dienal (PubChem CID 168967318) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is (2Z)-4-[methyl(propyl)amino]penta-2,4-dienal.
| Compound Name | (2Z)-4-[methyl(propyl)amino]penta-2,4-dienal |
|---|---|
| PubChem CID | 168967318 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (2Z)-4-[methyl(propyl)amino]penta-2,4-dienal |
| SMILES | C=C(/C=C\C=O)N(C)CCC |
| InChI | InChI=1S/C9H15NO/c1-4-7-10(3)9(2)6-5-8-11/h5-6,8H,2,4,7H2,1,3H3/b6-5- |
| InChIKey | OPIVGHULSASVCJ-WAYWQWQTSA-N |
| XLogP | 1.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|