C12H23N3O — CID 162729836
(Z,4Z)-4-[[2-[amino(methyl)amino]ethyl-methylamino]methylidene]hept-2-enal (PubChem CID 162729836) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is (Z,4Z)-4-[[2-[amino(methyl)amino]ethyl-methylamino]methylidene]hept-2-enal.
| Compound Name | (Z,4Z)-4-[[2-[amino(methyl)amino]ethyl-methylamino]methylidene]hept-2-enal |
|---|---|
| PubChem CID | 162729836 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | (Z,4Z)-4-[[2-[amino(methyl)amino]ethyl-methylamino]methylidene]hept-2-enal |
| SMILES | CCCC(/C=C\C=O)=C/N(C)CCN(C)N |
| InChI | InChI=1S/C12H23N3O/c1-4-6-12(7-5-10-16)11-14(2)8-9-15(3)13/h5,7,10-11H,4,6,8-9,13H2,1-3H3/b7-5-,12-11- |
| InChIKey | LEUWTSMPKIFKKV-PZZLUBSOSA-N |
| XLogP | 1.16 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|