About N-propylbutanehydrazide
N-propylbutanehydrazide (PubChem CID 165487733) has the molecular formula C7H16N2O
and a molecular weight of 144.22 g/mol. Its IUPAC name is N-propylbutanehydrazide.
Molecular Properties
| Compound Name | N-propylbutanehydrazide |
| PubChem CID | 165487733 |
| Molecular Formula | C7H16N2O |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | N-propylbutanehydrazide |
| SMILES | CCCC(=O)N(N)CCC |
| InChI | InChI=1S/C7H16N2O/c1-3-5-7(10)9(8)6-4-2/h3-6,8H2,1-2H3 |
| InChIKey | YFPBUFCDQJNZOJ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-propylbutanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propylbutanehydrazide?
The IUPAC name of N-propylbutanehydrazide (CID 165487733) is N-propylbutanehydrazide.
What is the SMILES notation for N-propylbutanehydrazide?
The canonical SMILES for N-propylbutanehydrazide is CCCC(=O)N(N)CCC.
What is the InChIKey of N-propylbutanehydrazide?
The InChIKey is YFPBUFCDQJNZOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O/c1-3-5-7(10)9(8)6-4-2/h3-6,8H2,1-2H3.
What are the key properties of N-propylbutanehydrazide?
N-propylbutanehydrazide has a molecular weight of 144.22 g/mol, XLogP of 0.90, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-propylbutanehydrazide is sourced from PubChem (CID 165487733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).