About N-butylpentanehydrazide
N-butylpentanehydrazide (PubChem CID 22613544) has the molecular formula C9H20N2O
and a molecular weight of 172.27 g/mol. Its IUPAC name is N-butylpentanehydrazide.
Molecular Properties
| Compound Name | N-butylpentanehydrazide |
| PubChem CID | 22613544 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | N-butylpentanehydrazide |
| SMILES | CCCCC(=O)N(N)CCCC |
| InChI | InChI=1S/C9H20N2O/c1-3-5-7-9(12)11(10)8-6-4-2/h3-8,10H2,1-2H3 |
| InChIKey | IERLPNFWKVEFGJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-butylpentanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butylpentanehydrazide?
The IUPAC name of N-butylpentanehydrazide (CID 22613544) is N-butylpentanehydrazide.
What is the SMILES notation for N-butylpentanehydrazide?
The canonical SMILES for N-butylpentanehydrazide is CCCCC(=O)N(N)CCCC.
What is the InChIKey of N-butylpentanehydrazide?
The InChIKey is IERLPNFWKVEFGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O/c1-3-5-7-9(12)11(10)8-6-4-2/h3-8,10H2,1-2H3.
What are the key properties of N-butylpentanehydrazide?
N-butylpentanehydrazide has a molecular weight of 172.27 g/mol, XLogP of 1.68, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butylpentanehydrazide is sourced from PubChem (CID 22613544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).