About (Z)-4-diazohex-2-enal
(Z)-4-diazohex-2-enal (PubChem CID 137278439) has the molecular formula C6H8N2O
and a molecular weight of 124.14 g/mol. Its IUPAC name is (Z)-4-diazohex-2-enal.
Molecular Properties
| Compound Name | (Z)-4-diazohex-2-enal |
| PubChem CID | 137278439 |
| Molecular Formula | C6H8N2O |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.06 |
| IUPAC Name | (Z)-4-diazohex-2-enal |
| SMILES | CCC(/C=C\C=O)=[N+]=[N-] |
| InChI | InChI=1S/C6H8N2O/c1-2-6(8-7)4-3-5-9/h3-5H,2H2,1H3/b4-3- |
| InChIKey | RXFCQBMHCWLWGG-ARJAWSKDSA-N |
| XLogP | 0.82 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-diazohex-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-diazohex-2-enal?
The IUPAC name of (Z)-4-diazohex-2-enal (CID 137278439) is (Z)-4-diazohex-2-enal.
What is the SMILES notation for (Z)-4-diazohex-2-enal?
The canonical SMILES for (Z)-4-diazohex-2-enal is CCC(/C=C\C=O)=[N+]=[N-].
What is the InChIKey of (Z)-4-diazohex-2-enal?
The InChIKey is RXFCQBMHCWLWGG-ARJAWSKDSA-N. The full InChI is InChI=1S/C6H8N2O/c1-2-6(8-7)4-3-5-9/h3-5H,2H2,1H3/b4-3-.
What are the key properties of (Z)-4-diazohex-2-enal?
(Z)-4-diazohex-2-enal has a molecular weight of 124.14 g/mol, XLogP of 0.82, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-diazohex-2-enal is sourced from PubChem (CID 137278439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).