C9H13NO3 — CID 88893184
(2E,4Z)-4-(nitromethyl)octa-2,4-dienal (PubChem CID 88893184) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is (2E,4Z)-4-(nitromethyl)octa-2,4-dienal.
| Compound Name | (2E,4Z)-4-(nitromethyl)octa-2,4-dienal |
|---|---|
| PubChem CID | 88893184 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | (2E,4Z)-4-(nitromethyl)octa-2,4-dienal |
| SMILES | CCC/C=C(/C=C/C=O)C[N+](=O)[O-] |
| InChI | InChI=1S/C9H13NO3/c1-2-3-5-9(6-4-7-11)8-10(12)13/h4-7H,2-3,8H2,1H3/b6-4+,9-5- |
| InChIKey | SONRELRLTAZVED-FBTALVJDSA-N |
| XLogP | 1.74 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|