C15H25NO2 — CID 145235865
(3E)-N,4-dimethyl-2-methylidene-5-oxo-N-propylhepta-3,6-dienamide;ethane (PubChem CID 145235865) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is (3E)-N,4-dimethyl-2-methylidene-5-oxo-N-propylhepta-3,6-dienamide;ethane.
| Compound Name | (3E)-N,4-dimethyl-2-methylidene-5-oxo-N-propylhepta-3,6-dienamide;ethane |
|---|---|
| PubChem CID | 145235865 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | (3E)-N,4-dimethyl-2-methylidene-5-oxo-N-propylhepta-3,6-dienamide;ethane |
| SMILES | C=CC(=O)/C(C)=C/C(=C)C(=O)N(C)CCC.CC |
| InChI | InChI=1S/C13H19NO2.C2H6/c1-6-8-14(5)13(16)11(4)9-10(3)12(15)7-2;1-2/h7,9H,2,4,6,8H2,1,3,5H3;1-2H3/b10-9+; |
| InChIKey | IUXJDACPHXATMA-RRABGKBLSA-N |
| XLogP | 3.14 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|