C10H19NO2 — CID 135192575
2-(hydroxymethyl)-N,3-dimethyl-N-propylbut-2-enamide (PubChem CID 135192575) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is 2-(hydroxymethyl)-N,3-dimethyl-N-propylbut-2-enamide.
| Compound Name | 2-(hydroxymethyl)-N,3-dimethyl-N-propylbut-2-enamide |
|---|---|
| PubChem CID | 135192575 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 2-(hydroxymethyl)-N,3-dimethyl-N-propylbut-2-enamide |
| SMILES | CCCN(C)C(=O)C(CO)=C(C)C |
| InChI | InChI=1S/C10H19NO2/c1-5-6-11(4)10(13)9(7-12)8(2)3/h12H,5-7H2,1-4H3 |
| InChIKey | IHYWOMHKPXTDNN-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|