C22H46N2O6 — CID 156865396
ethane;5-(2-formamidoethoxy)-N-[2-[2-(2-oxopropoxy)ethoxy]ethyl]pentanamide;pentane (PubChem CID 156865396) has the molecular formula C22H46N2O6 and a molecular weight of 434.62 g/mol. Its IUPAC name is ethane;5-(2-formamidoethoxy)-N-[2-[2-(2-oxopropoxy)ethoxy]ethyl]pentanamide;pentane.
| Compound Name | ethane;5-(2-formamidoethoxy)-N-[2-[2-(2-oxopropoxy)ethoxy]ethyl]pentanamide;pentane |
|---|---|
| PubChem CID | 156865396 |
| Molecular Formula | C22H46N2O6 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.34 |
| IUPAC Name | ethane;5-(2-formamidoethoxy)-N-[2-[2-(2-oxopropoxy)ethoxy]ethyl]pentanamide;pentane |
| SMILES | CC.CC(=O)COCCOCCNC(=O)CCCCOCCNC=O.CCCCC |
| InChI | InChI=1S/C15H28N2O6.C5H12.C2H6/c1-14(19)12-23-11-10-22-9-6-17-15(20)4-2-3-7-21-8-5-16-13-18;1-3-5-4-2;1-2/h13H,2-12H2,1H3,(H,16,18)(H,17,20);3-5H2,1-2H3;1-2H3 |
| InChIKey | UVHSLLAATRKNCF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|