C12H18O — CID 88838663
(4E,7Z)-2,8-dimethyldeca-4,7,9-trienal (PubChem CID 88838663) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is (4E,7Z)-2,8-dimethyldeca-4,7,9-trienal.
| Compound Name | (4E,7Z)-2,8-dimethyldeca-4,7,9-trienal |
|---|---|
| PubChem CID | 88838663 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (4E,7Z)-2,8-dimethyldeca-4,7,9-trienal |
| SMILES | C=C/C(C)=C\C/C=C/CC(C)C=O |
| InChI | InChI=1S/C12H18O/c1-4-11(2)8-6-5-7-9-12(3)10-13/h4-5,7-8,10,12H,1,6,9H2,2-3H3/b7-5+,11-8- |
| InChIKey | IIEMAOKXCMALOS-BFPPUAHJSA-N |
| XLogP | 3.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|