C12H22 — CID 91478498
3,6-dimethyldeca-1,3-diene (PubChem CID 91478498) has the molecular formula C12H22 and a molecular weight of 166.31 g/mol. Its IUPAC name is 3,6-dimethyldeca-1,3-diene.
| Compound Name | 3,6-dimethyldeca-1,3-diene |
|---|---|
| PubChem CID | 91478498 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | 3,6-dimethyldeca-1,3-diene |
| SMILES | C=CC(C)=CCC(C)CCCC |
| InChI | InChI=1S/C12H22/c1-5-7-8-12(4)10-9-11(3)6-2/h6,9,12H,2,5,7-8,10H2,1,3-4H3 |
| InChIKey | ZCPFDYCHSLXFCE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|