C12H22 — CID 123175368
2,6-dimethyldeca-2,3-diene (PubChem CID 123175368) has the molecular formula C12H22 and a molecular weight of 166.31 g/mol. Its IUPAC name is 2,6-dimethyldeca-2,3-diene.
| Compound Name | 2,6-dimethyldeca-2,3-diene |
|---|---|
| PubChem CID | 123175368 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | 2,6-dimethyldeca-2,3-diene |
| SMILES | CCCCC(C)CC=C=C(C)C |
| InChI | InChI=1S/C12H22/c1-5-6-9-12(4)10-7-8-11(2)3/h7,12H,5-6,9-10H2,1-4H3 |
| InChIKey | GIPUFULLUJAIOI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |