C26H46O — CID 141011255
6-methyl-2-(6-methyldodeca-1,3-dien-2-yloxy)dodeca-1,3-diene (PubChem CID 141011255) has the molecular formula C26H46O and a molecular weight of 374.65 g/mol. Its IUPAC name is 6-methyl-2-(6-methyldodeca-1,3-dien-2-yloxy)dodeca-1,3-diene.
| Compound Name | 6-methyl-2-(6-methyldodeca-1,3-dien-2-yloxy)dodeca-1,3-diene |
|---|---|
| PubChem CID | 141011255 |
| Molecular Formula | C26H46O |
| Molecular Weight | 374.65 g/mol |
| Exact Mass | 374.35 |
| IUPAC Name | 6-methyl-2-(6-methyldodeca-1,3-dien-2-yloxy)dodeca-1,3-diene |
| SMILES | C=C(C=CCC(C)CCCCCC)OC(=C)C=CCC(C)CCCCCC |
| InChI | InChI=1S/C26H46O/c1-7-9-11-13-17-23(3)19-15-21-25(5)27-26(6)22-16-20-24(4)18-14-12-10-8-2/h15-16,21-24H,5-14,17-20H2,1-4H3 |
| InChIKey | AGFJOCNBSPNEAN-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.65 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|