C19H36 — CID 91752281
(3E)-2,6,10-trimethylhexadeca-1,3-diene (PubChem CID 91752281) has the molecular formula C19H36 and a molecular weight of 264.50 g/mol. Its IUPAC name is (3E)-2,6,10-trimethylhexadeca-1,3-diene.
| Compound Name | (3E)-2,6,10-trimethylhexadeca-1,3-diene |
|---|---|
| PubChem CID | 91752281 |
| Molecular Formula | C19H36 |
| Molecular Weight | 264.50 g/mol |
| Exact Mass | 264.28 |
| IUPAC Name | (3E)-2,6,10-trimethylhexadeca-1,3-diene |
| SMILES | C=C(C)/C=C/CC(C)CCCC(C)CCCCCC |
| InChI | InChI=1S/C19H36/c1-6-7-8-9-13-18(4)15-11-16-19(5)14-10-12-17(2)3/h10,12,18-19H,2,6-9,11,13-16H2,1,3-5H3/b12-10+ |
| InChIKey | ULHQOMQHIURLGG-ZRDIBKRKSA-N |
| XLogP | 6.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.50 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|