C15H22O — CID 118976608
(2Z,6E,9E)-2,6,10-trimethyldodeca-2,6,9,11-tetraenal (PubChem CID 118976608) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is (2Z,6E,9E)-2,6,10-trimethyldodeca-2,6,9,11-tetraenal.
| Compound Name | (2Z,6E,9E)-2,6,10-trimethyldodeca-2,6,9,11-tetraenal |
|---|---|
| PubChem CID | 118976608 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | (2Z,6E,9E)-2,6,10-trimethyldodeca-2,6,9,11-tetraenal |
| SMILES | C=C/C(C)=C/C/C=C(\C)CC/C=C(/C)C=O |
| InChI | InChI=1S/C15H22O/c1-5-13(2)8-6-9-14(3)10-7-11-15(4)12-16/h5,8-9,11-12H,1,6-7,10H2,2-4H3/b13-8+,14-9+,15-11- |
| InChIKey | PFSTYGCNVAVZBK-VCIUYEIQSA-N |
| XLogP | 4.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|