C16H26 — CID 14753114
(3E,6E)-7-ethyl-3,11-dimethyldodeca-1,3,6,10-tetraene (PubChem CID 14753114) has the molecular formula C16H26 and a molecular weight of 218.38 g/mol. Its IUPAC name is (3E,6E)-7-ethyl-3,11-dimethyldodeca-1,3,6,10-tetraene.
| Compound Name | (3E,6E)-7-ethyl-3,11-dimethyldodeca-1,3,6,10-tetraene |
|---|---|
| PubChem CID | 14753114 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | (3E,6E)-7-ethyl-3,11-dimethyldodeca-1,3,6,10-tetraene |
| SMILES | C=C/C(C)=C/C/C=C(\CC)CCC=C(C)C |
| InChI | InChI=1S/C16H26/c1-6-15(5)11-9-13-16(7-2)12-8-10-14(3)4/h6,10-11,13H,1,7-9,12H2,2-5H3/b15-11+,16-13+ |
| InChIKey | LPHPRLLVGKQFEL-NWFDBUFXSA-N |
| XLogP | 5.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|