C13H19N — CID 165348510
(4Z,8E)-5,9-dimethylundeca-4,8,10-trienenitrile (PubChem CID 165348510) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is (4Z,8E)-5,9-dimethylundeca-4,8,10-trienenitrile.
| Compound Name | (4Z,8E)-5,9-dimethylundeca-4,8,10-trienenitrile |
|---|---|
| PubChem CID | 165348510 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | (4Z,8E)-5,9-dimethylundeca-4,8,10-trienenitrile |
| SMILES | C=C/C(C)=C/CC/C(C)=C\CCC#N |
| InChI | InChI=1S/C13H19N/c1-4-12(2)9-7-10-13(3)8-5-6-11-14/h4,8-9H,1,5-7,10H2,2-3H3/b12-9+,13-8- |
| InChIKey | DGNJSHMWQYXXNC-OYQWPQAFSA-N |
| XLogP | 4.15 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|