C15H24O2S — CID 12572219
(2E)-3,7-dimethyl-1-[(1E)-2-methylbuta-1,3-dienyl]sulfonylocta-2,6-diene (PubChem CID 12572219) has the molecular formula C15H24O2S and a molecular weight of 268.42 g/mol. Its IUPAC name is (2E)-3,7-dimethyl-1-[(1E)-2-methylbuta-1,3-dienyl]sulfonylocta-2,6-diene.
| Compound Name | (2E)-3,7-dimethyl-1-[(1E)-2-methylbuta-1,3-dienyl]sulfonylocta-2,6-diene |
|---|---|
| PubChem CID | 12572219 |
| Molecular Formula | C15H24O2S |
| Molecular Weight | 268.42 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | (2E)-3,7-dimethyl-1-[(1E)-2-methylbuta-1,3-dienyl]sulfonylocta-2,6-diene |
| SMILES | C=C/C(C)=C/S(=O)(=O)C/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C15H24O2S/c1-6-14(4)12-18(16,17)11-10-15(5)9-7-8-13(2)3/h6,8,10,12H,1,7,9,11H2,2-5H3/b14-12+,15-10+ |
| InChIKey | RMIHUOUNWSCAID-KPWNYXQSSA-N |
| XLogP | 4.18 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|