C11H21NO2S — CID 56942264
(1Z)-N,N,2,6-tetramethylhepta-1,5-diene-1-sulfonamide (PubChem CID 56942264) has the molecular formula C11H21NO2S and a molecular weight of 231.36 g/mol. Its IUPAC name is (1Z)-N,N,2,6-tetramethylhepta-1,5-diene-1-sulfonamide.
| Compound Name | (1Z)-N,N,2,6-tetramethylhepta-1,5-diene-1-sulfonamide |
|---|---|
| PubChem CID | 56942264 |
| Molecular Formula | C11H21NO2S |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | (1Z)-N,N,2,6-tetramethylhepta-1,5-diene-1-sulfonamide |
| SMILES | CC(C)=CCC/C(C)=C\S(=O)(=O)N(C)C |
| InChI | InChI=1S/C11H21NO2S/c1-10(2)7-6-8-11(3)9-15(13,14)12(4)5/h7,9H,6,8H2,1-5H3/b11-9- |
| InChIKey | POQXRFKHXZIQFD-LUAWRHEFSA-N |
| XLogP | 2.53 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|