C10H17O3SSe- — CID 59008376
(2E)-3,7-dimethyl-1-sulfonatoselanylocta-2,6-diene (PubChem CID 59008376) has the molecular formula C10H17O3SSe- and a molecular weight of 296.27 g/mol. Its IUPAC name is (2E)-3,7-dimethyl-1-sulfonatoselanylocta-2,6-diene.
| Compound Name | (2E)-3,7-dimethyl-1-sulfonatoselanylocta-2,6-diene |
|---|---|
| PubChem CID | 59008376 |
| Molecular Formula | C10H17O3SSe- |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | (2E)-3,7-dimethyl-1-sulfonatoselanylocta-2,6-diene |
| SMILES | CC(C)=CCC/C(C)=C/C[Se]S(=O)(=O)[O-] |
| InChI | InChI=1S/C10H18O3SSe/c1-9(2)5-4-6-10(3)7-8-15-14(11,12)13/h5,7H,4,6,8H2,1-3H3,(H,11,12,13)/p-1/b10-7+ |
| InChIKey | PSVWNIOPIOBVAQ-JXMROGBWSA-M |
| XLogP | 2.26 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|