C11H19NO2 — CID 54538014
N-hydroxy-N,3,7-trimethylocta-2,6-dienamide (PubChem CID 54538014) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is N-hydroxy-N,3,7-trimethylocta-2,6-dienamide.
| Compound Name | N-hydroxy-N,3,7-trimethylocta-2,6-dienamide |
|---|---|
| PubChem CID | 54538014 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | N-hydroxy-N,3,7-trimethylocta-2,6-dienamide |
| SMILES | CC(C)=CCCC(C)=CC(=O)N(C)O |
| InChI | InChI=1S/C11H19NO2/c1-9(2)6-5-7-10(3)8-11(13)12(4)14/h6,8,14H,5,7H2,1-4H3 |
| InChIKey | ZBDNKWRDCQVRLI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|