C10H12F8 — CID 141171044
1,1,1,2,2-pentafluoro-5-(trifluoromethyl)non-3-ene (PubChem CID 141171044) has the molecular formula C10H12F8 and a molecular weight of 284.19 g/mol. Its IUPAC name is 1,1,1,2,2-pentafluoro-5-(trifluoromethyl)non-3-ene.
| Compound Name | 1,1,1,2,2-pentafluoro-5-(trifluoromethyl)non-3-ene |
|---|---|
| PubChem CID | 141171044 |
| Molecular Formula | C10H12F8 |
| Molecular Weight | 284.19 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 1,1,1,2,2-pentafluoro-5-(trifluoromethyl)non-3-ene |
| SMILES | CCCCC(C=CC(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H12F8/c1-2-3-4-7(9(13,14)15)5-6-8(11,12)10(16,17)18/h5-7H,2-4H2,1H3 |
| InChIKey | SZBBZYWXNQGOJI-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.19 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|