C17H23F3O2 — CID 102104350
[(E,1S)-1-(methoxymethoxy)-4-(trifluoromethyl)oct-2-enyl]benzene (PubChem CID 102104350) has the molecular formula C17H23F3O2 and a molecular weight of 316.36 g/mol. Its IUPAC name is [(E,1S)-1-(methoxymethoxy)-4-(trifluoromethyl)oct-2-enyl]benzene.
| Compound Name | [(E,1S)-1-(methoxymethoxy)-4-(trifluoromethyl)oct-2-enyl]benzene |
|---|---|
| PubChem CID | 102104350 |
| Molecular Formula | C17H23F3O2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | [(E,1S)-1-(methoxymethoxy)-4-(trifluoromethyl)oct-2-enyl]benzene |
| SMILES | CCCCC(/C=C/[C@H](OCOC)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H23F3O2/c1-3-4-10-15(17(18,19)20)11-12-16(22-13-21-2)14-8-6-5-7-9-14/h5-9,11-12,15-16H,3-4,10,13H2,1-2H3/b12-11+/t15?,16-/m0/s1 |
| InChIKey | MMXAQONFNSMGSW-DXMKLJGBSA-N |
| XLogP | 5.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|