C15H17F3O4 — CID 102104348
[(Z,1R)-5,5,5-trifluoro-1-(methoxymethoxy)-1-phenylpent-3-en-2-yl] acetate (PubChem CID 102104348) has the molecular formula C15H17F3O4 and a molecular weight of 318.29 g/mol. Its IUPAC name is [(Z,1R)-5,5,5-trifluoro-1-(methoxymethoxy)-1-phenylpent-3-en-2-yl] acetate.
| Compound Name | [(Z,1R)-5,5,5-trifluoro-1-(methoxymethoxy)-1-phenylpent-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 102104348 |
| Molecular Formula | C15H17F3O4 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | [(Z,1R)-5,5,5-trifluoro-1-(methoxymethoxy)-1-phenylpent-3-en-2-yl] acetate |
| SMILES | COCO[C@H](c1ccccc1)C(/C=C\C(F)(F)F)OC(C)=O |
| InChI | InChI=1S/C15H17F3O4/c1-11(19)22-13(8-9-15(16,17)18)14(21-10-20-2)12-6-4-3-5-7-12/h3-9,13-14H,10H2,1-2H3/b9-8-/t13?,14-/m1/s1 |
| InChIKey | LBYPGYWEUKOBSX-YWHCCUJGSA-N |
| XLogP | 3.40 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|