C13H20O5 — CID 134857946
(3R,4S,5R)-5-(methoxymethoxy)-5-phenylpentane-1,3,4-triol (PubChem CID 134857946) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is (3R,4S,5R)-5-(methoxymethoxy)-5-phenylpentane-1,3,4-triol.
| Compound Name | (3R,4S,5R)-5-(methoxymethoxy)-5-phenylpentane-1,3,4-triol |
|---|---|
| PubChem CID | 134857946 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | (3R,4S,5R)-5-(methoxymethoxy)-5-phenylpentane-1,3,4-triol |
| SMILES | COCO[C@H](c1ccccc1)[C@@H](O)[C@H](O)CCO |
| InChI | InChI=1S/C13H20O5/c1-17-9-18-13(10-5-3-2-4-6-10)12(16)11(15)7-8-14/h2-6,11-16H,7-9H2,1H3/t11-,12+,13-/m1/s1 |
| InChIKey | ACWDUKXUOOGMTP-FRRDWIJNSA-N |
| XLogP | 0.45 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|