C17H18BrN3O2 — CID 72546689
1-[(1R,2R)-3-azido-1-(methoxymethoxy)-1-phenylpropan-2-yl]-4-bromobenzene (PubChem CID 72546689) has the molecular formula C17H18BrN3O2 and a molecular weight of 376.25 g/mol. Its IUPAC name is 1-[(1R,2R)-3-azido-1-(methoxymethoxy)-1-phenylpropan-2-yl]-4-bromobenzene.
| Compound Name | 1-[(1R,2R)-3-azido-1-(methoxymethoxy)-1-phenylpropan-2-yl]-4-bromobenzene |
|---|---|
| PubChem CID | 72546689 |
| Molecular Formula | C17H18BrN3O2 |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 1-[(1R,2R)-3-azido-1-(methoxymethoxy)-1-phenylpropan-2-yl]-4-bromobenzene |
| SMILES | COCO[C@@H](c1ccccc1)[C@@H](CN=[N+]=[N-])c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H18BrN3O2/c1-22-12-23-17(14-5-3-2-4-6-14)16(11-20-21-19)13-7-9-15(18)10-8-13/h2-10,16-17H,11-12H2,1H3/t16-,17-/m0/s1 |
| InChIKey | WCZFCEGDGZXQRV-IRXDYDNUSA-N |
| XLogP | 5.20 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|