C9H10BrN3O4S — CID 101160638
[(1R,2R)-3-azido-2-bromo-1-phenylpropyl] hydrogen sulfate (PubChem CID 101160638) has the molecular formula C9H10BrN3O4S and a molecular weight of 336.17 g/mol. Its IUPAC name is [(1R,2R)-3-azido-2-bromo-1-phenylpropyl] hydrogen sulfate.
| Compound Name | [(1R,2R)-3-azido-2-bromo-1-phenylpropyl] hydrogen sulfate |
|---|---|
| PubChem CID | 101160638 |
| Molecular Formula | C9H10BrN3O4S |
| Molecular Weight | 336.17 g/mol |
| Exact Mass | 334.96 |
| IUPAC Name | [(1R,2R)-3-azido-2-bromo-1-phenylpropyl] hydrogen sulfate |
| SMILES | [N-]=[N+]=NC[C@@H](Br)[C@H](OS(=O)(=O)O)c1ccccc1 |
| InChI | InChI=1S/C9H10BrN3O4S/c10-8(6-12-13-11)9(17-18(14,15)16)7-4-2-1-3-5-7/h1-5,8-9H,6H2,(H,14,15,16)/t8-,9-/m1/s1 |
| InChIKey | OUTQMGVFZANUEK-RKDXNWHRSA-N |
| XLogP | 2.62 |
| TPSA | 112.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.17 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|