C19H20BrN3O2 — CID 72546935
1-[(2R,3R)-2-(4-bromophenyl)-3-(methoxymethoxy)-3-phenylpropyl]triazole (PubChem CID 72546935) has the molecular formula C19H20BrN3O2 and a molecular weight of 402.29 g/mol. Its IUPAC name is 1-[(2R,3R)-2-(4-bromophenyl)-3-(methoxymethoxy)-3-phenylpropyl]triazole.
| Compound Name | 1-[(2R,3R)-2-(4-bromophenyl)-3-(methoxymethoxy)-3-phenylpropyl]triazole |
|---|---|
| PubChem CID | 72546935 |
| Molecular Formula | C19H20BrN3O2 |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 1-[(2R,3R)-2-(4-bromophenyl)-3-(methoxymethoxy)-3-phenylpropyl]triazole |
| SMILES | COCO[C@@H](c1ccccc1)[C@@H](Cn1ccnn1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H20BrN3O2/c1-24-14-25-19(16-5-3-2-4-6-16)18(13-23-12-11-21-22-23)15-7-9-17(20)10-8-15/h2-12,18-19H,13-14H2,1H3/t18-,19-/m0/s1 |
| InChIKey | SWQHVRSNSNSTAN-OALUTQOASA-N |
| XLogP | 4.19 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|