C40H36Br2O2Si2 — CID 102172487
[(1S,2S)-1,2-bis(4-bromophenyl)-2-[methyl(diphenyl)silyl]oxyethoxy]-methyl-diphenylsilane (PubChem CID 102172487) has the molecular formula C40H36Br2O2Si2 and a molecular weight of 764.71 g/mol. Its IUPAC name is [(1S,2S)-1,2-bis(4-bromophenyl)-2-[methyl(diphenyl)silyl]oxyethoxy]-methyl-diphenylsilane.
| Compound Name | [(1S,2S)-1,2-bis(4-bromophenyl)-2-[methyl(diphenyl)silyl]oxyethoxy]-methyl-diphenylsilane |
|---|---|
| PubChem CID | 102172487 |
| Molecular Formula | C40H36Br2O2Si2 |
| Molecular Weight | 764.71 g/mol |
| Exact Mass | 762.06 |
| IUPAC Name | [(1S,2S)-1,2-bis(4-bromophenyl)-2-[methyl(diphenyl)silyl]oxyethoxy]-methyl-diphenylsilane |
| SMILES | C[Si](O[C@@H](c1ccc(Br)cc1)[C@@H](O[Si](C)(c1ccccc1)c1ccccc1)c1ccc(Br)cc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H36Br2O2Si2/c1-45(35-15-7-3-8-16-35,36-17-9-4-10-18-36)43-39(31-23-27-33(41)28-24-31)40(32-25-29-34(42)30-26-32)44-46(2,37-19-11-5-12-20-37)38-21-13-6-14-22-38/h3-30,39-40H,1-2H3/t39-,40-/m0/s1 |
| InChIKey | IYGBXLXWCRCWTB-ZAQUEYBZSA-N |
| XLogP | 8.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.71 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|