C16H25BrO2Si — CID 135019858
(2S,3S)-3-(4-bromophenyl)-2-methyl-3-triethylsilyloxypropanal (PubChem CID 135019858) has the molecular formula C16H25BrO2Si and a molecular weight of 357.36 g/mol. Its IUPAC name is (2S,3S)-3-(4-bromophenyl)-2-methyl-3-triethylsilyloxypropanal.
| Compound Name | (2S,3S)-3-(4-bromophenyl)-2-methyl-3-triethylsilyloxypropanal |
|---|---|
| PubChem CID | 135019858 |
| Molecular Formula | C16H25BrO2Si |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | (2S,3S)-3-(4-bromophenyl)-2-methyl-3-triethylsilyloxypropanal |
| SMILES | CC[Si](CC)(CC)O[C@H](c1ccc(Br)cc1)C(C)C=O |
| InChI | InChI=1S/C16H25BrO2Si/c1-5-20(6-2,7-3)19-16(13(4)12-18)14-8-10-15(17)11-9-14/h8-13,16H,5-7H2,1-4H3/t13?,16-/m0/s1 |
| InChIKey | FXQCBRPVURXCSM-VYIIXAMBSA-N |
| XLogP | 5.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|