About CID 177448300
CID 177448300 (PubChem CID 177448300) has the molecular formula C28H43BrNO2SSi+
and a molecular weight of 565.71 g/mol.
Molecular Properties
| Compound Name | CID 177448300 |
| PubChem CID | 177448300 |
| Molecular Formula | C28H43BrNO2SSi+ |
| Molecular Weight | 565.71 g/mol |
| Exact Mass | 564.20 |
| IUPAC Name | — |
| SMILES | CC[Si](CC)(CC)O[C@@H](c1ccc(Br)cc1)[C@H](/C=C(\C)[S+](=O)(c1ccccc1)N(C)C)C(C)C |
| InChI | InChI=1S/C28H43BrNO2SSi/c1-9-34(10-2,11-3)32-28(24-17-19-25(29)20-18-24)27(22(4)5)21-23(6)33(31,30(7)8)26-15-13-12-14-16-26/h12-22,27-28H,9-11H2,1-8H3/q+1/b23-21+/t27-,28+,33?/m1/s1 |
| InChIKey | QYTITDASLWUWLU-MHDAJJFLSA-N |
| XLogP | 8.72 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 565.71 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 177448300 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177448300?
The IUPAC name of CID 177448300 (CID 177448300) is not available.
What is the SMILES notation for CID 177448300?
The canonical SMILES for CID 177448300 is CC[Si](CC)(CC)O[C@@H](c1ccc(Br)cc1)[C@H](/C=C(\C)[S+](=O)(c1ccccc1)N(C)C)C(C)C.
What is the InChIKey of CID 177448300?
The InChIKey is QYTITDASLWUWLU-MHDAJJFLSA-N. The full InChI is InChI=1S/C28H43BrNO2SSi/c1-9-34(10-2,11-3)32-28(24-17-19-25(29)20-18-24)27(22(4)5)21-23(6)33(31,30(7)8)26-15-13-12-14-16-26/h12-22,27-28H,9-11H2,1-8H3/q+1/b23-21+/t27-,28+,33?/m1/s1.
What are the key properties of CID 177448300?
CID 177448300 has a molecular weight of 565.71 g/mol, XLogP of 8.72, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177448300 is sourced from PubChem (CID 177448300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).