C28H43BrNO2SSi+ — CID 177448300
CID 177448300 (PubChem CID 177448300) has the molecular formula C28H43BrNO2SSi+ and a molecular weight of 565.71 g/mol.
| Compound Name | CID 177448300 |
|---|---|
| PubChem CID | 177448300 |
| Molecular Formula | C28H43BrNO2SSi+ |
| Molecular Weight | 565.71 g/mol |
| Exact Mass | 564.20 |
| IUPAC Name | — |
| SMILES | CC[Si](CC)(CC)O[C@@H](c1ccc(Br)cc1)[C@H](/C=C(\C)[S+](=O)(c1ccccc1)N(C)C)C(C)C |
| InChI | InChI=1S/C28H43BrNO2SSi/c1-9-34(10-2,11-3)32-28(24-17-19-25(29)20-18-24)27(22(4)5)21-23(6)33(31,30(7)8)26-15-13-12-14-16-26/h12-22,27-28H,9-11H2,1-8H3/q+1/b23-21+/t27-,28+,33?/m1/s1 |
| InChIKey | QYTITDASLWUWLU-MHDAJJFLSA-N |
| XLogP | 8.72 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.71 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|