C13H28O2Si — CID 15440865
(2R,3S)-2,4-dimethyl-3-triethylsilyloxypentanal (PubChem CID 15440865) has the molecular formula C13H28O2Si and a molecular weight of 244.45 g/mol. Its IUPAC name is (2R,3S)-2,4-dimethyl-3-triethylsilyloxypentanal.
| Compound Name | (2R,3S)-2,4-dimethyl-3-triethylsilyloxypentanal |
|---|---|
| PubChem CID | 15440865 |
| Molecular Formula | C13H28O2Si |
| Molecular Weight | 244.45 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | (2R,3S)-2,4-dimethyl-3-triethylsilyloxypentanal |
| SMILES | CC[Si](CC)(CC)O[C@@H](C(C)C)[C@@H](C)C=O |
| InChI | InChI=1S/C13H28O2Si/c1-7-16(8-2,9-3)15-13(11(4)5)12(6)10-14/h10-13H,7-9H2,1-6H3/t12-,13-/m0/s1 |
| InChIKey | BRIANZOUXNACKK-STQMWFEESA-N |
| XLogP | 3.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|