C22H34O6Si — CID 10093737
[(2R,3S,4S,5S)-6-methoxy-3,5-dimethyl-1,6-dioxo-4-triethylsilyloxyhexan-2-yl] benzoate (PubChem CID 10093737) has the molecular formula C22H34O6Si and a molecular weight of 422.59 g/mol. Its IUPAC name is [(2R,3S,4S,5S)-6-methoxy-3,5-dimethyl-1,6-dioxo-4-triethylsilyloxyhexan-2-yl] benzoate.
| Compound Name | [(2R,3S,4S,5S)-6-methoxy-3,5-dimethyl-1,6-dioxo-4-triethylsilyloxyhexan-2-yl] benzoate |
|---|---|
| PubChem CID | 10093737 |
| Molecular Formula | C22H34O6Si |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | [(2R,3S,4S,5S)-6-methoxy-3,5-dimethyl-1,6-dioxo-4-triethylsilyloxyhexan-2-yl] benzoate |
| SMILES | CC[Si](CC)(CC)O[C@@H]([C@@H](C)[C@H](C=O)OC(=O)c1ccccc1)[C@H](C)C(=O)OC |
| InChI | InChI=1S/C22H34O6Si/c1-7-29(8-2,9-3)28-20(17(5)21(24)26-6)16(4)19(15-23)27-22(25)18-13-11-10-12-14-18/h10-17,19-20H,7-9H2,1-6H3/t16-,17-,19-,20-/m0/s1 |
| InChIKey | PHJAUJGHLWPHHQ-ZULIPRJHSA-N |
| XLogP | 4.25 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|