C16H23NO3 — CID 158104237
[(2R,3R,4S)-1-methoxyimino-3,4-dimethylhexan-2-yl] benzoate (PubChem CID 158104237) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is [(2R,3R,4S)-1-methoxyimino-3,4-dimethylhexan-2-yl] benzoate.
| Compound Name | [(2R,3R,4S)-1-methoxyimino-3,4-dimethylhexan-2-yl] benzoate |
|---|---|
| PubChem CID | 158104237 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | [(2R,3R,4S)-1-methoxyimino-3,4-dimethylhexan-2-yl] benzoate |
| SMILES | CC[C@H](C)[C@@H](C)[C@H](C=NOC)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H23NO3/c1-5-12(2)13(3)15(11-17-19-4)20-16(18)14-9-7-6-8-10-14/h6-13,15H,5H2,1-4H3/t12-,13+,15-/m0/s1 |
| InChIKey | IVSCHTQAQWYXHF-GUTXKFCHSA-N |
| XLogP | 3.53 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|