About dichloromethane;2,3-dimethylbutanal
dichloromethane;2,3-dimethylbutanal (PubChem CID 174845738) has the molecular formula C7H14Cl2O
and a molecular weight of 185.09 g/mol. Its IUPAC name is dichloromethane;2,3-dimethylbutanal.
Molecular Properties
| Compound Name | dichloromethane;2,3-dimethylbutanal |
| PubChem CID | 174845738 |
| Molecular Formula | C7H14Cl2O |
| Molecular Weight | 185.09 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | dichloromethane;2,3-dimethylbutanal |
| SMILES | CC(C)C(C)C=O.ClCCl |
| InChI | InChI=1S/C6H12O.CH2Cl2/c1-5(2)6(3)4-7;2-1-3/h4-6H,1-3H3;1H2 |
| InChIKey | RIINKWZIZUIJNG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.09 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze dichloromethane;2,3-dimethylbutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloromethane;2,3-dimethylbutanal?
The IUPAC name of dichloromethane;2,3-dimethylbutanal (CID 174845738) is dichloromethane;2,3-dimethylbutanal.
What is the SMILES notation for dichloromethane;2,3-dimethylbutanal?
The canonical SMILES for dichloromethane;2,3-dimethylbutanal is CC(C)C(C)C=O.ClCCl.
What is the InChIKey of dichloromethane;2,3-dimethylbutanal?
The InChIKey is RIINKWZIZUIJNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O.CH2Cl2/c1-5(2)6(3)4-7;2-1-3/h4-6H,1-3H3;1H2.
What are the key properties of dichloromethane;2,3-dimethylbutanal?
dichloromethane;2,3-dimethylbutanal has a molecular weight of 185.09 g/mol, XLogP of 2.90, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromethane;2,3-dimethylbutanal is sourced from PubChem (CID 174845738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).