C7H13NO2 — CID 174582773
N-(2,3-dimethyl-4-oxobutyl)formamide (PubChem CID 174582773) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is N-(2,3-dimethyl-4-oxobutyl)formamide.
| Compound Name | N-(2,3-dimethyl-4-oxobutyl)formamide |
|---|---|
| PubChem CID | 174582773 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | N-(2,3-dimethyl-4-oxobutyl)formamide |
| SMILES | CC(C=O)C(C)CNC=O |
| InChI | InChI=1S/C7H13NO2/c1-6(3-8-5-10)7(2)4-9/h4-7H,3H2,1-2H3,(H,8,10) |
| InChIKey | WEDWPYUHIOTDRS-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|