C10H21NO2 — CID 90790560
3-[(2-hydroxyethylamino)methyl]-2,4-dimethylpentanal (PubChem CID 90790560) has the molecular formula C10H21NO2 and a molecular weight of 187.28 g/mol. Its IUPAC name is 3-[(2-hydroxyethylamino)methyl]-2,4-dimethylpentanal.
| Compound Name | 3-[(2-hydroxyethylamino)methyl]-2,4-dimethylpentanal |
|---|---|
| PubChem CID | 90790560 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | 3-[(2-hydroxyethylamino)methyl]-2,4-dimethylpentanal |
| SMILES | CC(C)C(CNCCO)C(C)C=O |
| InChI | InChI=1S/C10H21NO2/c1-8(2)10(9(3)7-13)6-11-4-5-12/h7-12H,4-6H2,1-3H3 |
| InChIKey | SPGLPUIFIXIJGV-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|